C17H23N5O3S — CID 125170085
1-[4-(propylsulfamoyl)phenyl]-3-[(2R)-1-pyrazin-2-ylpropan-2-yl]urea (PubChem CID 125170085) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-[4-(propylsulfamoyl)phenyl]-3-[(2R)-1-pyrazin-2-ylpropan-2-yl]urea.
| Compound Name | 1-[4-(propylsulfamoyl)phenyl]-3-[(2R)-1-pyrazin-2-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 125170085 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[4-(propylsulfamoyl)phenyl]-3-[(2R)-1-pyrazin-2-ylpropan-2-yl]urea |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)N[C@H](C)Cc2cnccn2)cc1 |
| InChI | InChI=1S/C17H23N5O3S/c1-3-8-20-26(24,25)16-6-4-14(5-7-16)22-17(23)21-13(2)11-15-12-18-9-10-19-15/h4-7,9-10,12-13,20H,3,8,11H2,1-2H3,(H2,21,22,23)/t13-/m1/s1 |
| InChIKey | WHKWUZGIORGYAZ-CYBMUJFWSA-N |
| XLogP | 1.92 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |