C16H22N2OS — CID 118762697
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide (PubChem CID 118762697) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 118762697 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]acetamide |
| SMILES | Cc1csc(CCCNC(=O)C[C@@H]2C[C@@H]3C=C[C@H]2C3)n1 |
| InChI | InChI=1S/C16H22N2OS/c1-11-10-20-16(18-11)3-2-6-17-15(19)9-14-8-12-4-5-13(14)7-12/h4-5,10,12-14H,2-3,6-9H2,1H3,(H,17,19)/t12-,13+,14+/m1/s1 |
| InChIKey | QRKPIVUSWOTAAM-RDBSUJKOSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|