C24H27NO3 — CID 118764215
(3aR,6S,7aR)-2-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 118764215) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (3aR,6S,7aR)-2-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-2-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 118764215 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3aR,6S,7aR)-2-(2,3-dihydro-1-benzofuran-5-ylmethyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12CC[C@H](c3ccccc3)C[C@H]1CN(Cc1ccc3c(c1)CCO3)C2 |
| InChI | InChI=1S/C24H27NO3/c26-23(27)24-10-8-19(18-4-2-1-3-5-18)13-21(24)15-25(16-24)14-17-6-7-22-20(12-17)9-11-28-22/h1-7,12,19,21H,8-11,13-16H2,(H,26,27)/t19-,21-,24-/m0/s1 |
| InChIKey | UWHOKLXBZDXHKR-PTLVVNQVSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |