C19H22N4O3 — CID 118795941
(3aR,6S,7aR)-6-phenyl-2-[2-(triazol-1-yl)acetyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 118795941) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3aR,6S,7aR)-6-phenyl-2-[2-(triazol-1-yl)acetyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-6-phenyl-2-[2-(triazol-1-yl)acetyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 118795941 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3aR,6S,7aR)-6-phenyl-2-[2-(triazol-1-yl)acetyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | O=C(Cn1ccnn1)N1C[C@@H]2C[C@@H](c3ccccc3)CC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H22N4O3/c24-17(12-23-9-8-20-21-23)22-11-16-10-15(14-4-2-1-3-5-14)6-7-19(16,13-22)18(25)26/h1-5,8-9,15-16H,6-7,10-13H2,(H,25,26)/t15-,16-,19-/m0/s1 |
| InChIKey | CLEOPMKHLXQXMX-BXWFABGCSA-N |
| XLogP | 1.78 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |