C21H21ClN2O3 — CID 119058985
(3aR,6S,7aR)-2-(3-chloropyridine-4-carbonyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 119058985) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (3aR,6S,7aR)-2-(3-chloropyridine-4-carbonyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-2-(3-chloropyridine-4-carbonyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 119058985 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (3aR,6S,7aR)-2-(3-chloropyridine-4-carbonyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | O=C(c1ccncc1Cl)N1C[C@@H]2C[C@@H](c3ccccc3)CC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C21H21ClN2O3/c22-18-11-23-9-7-17(18)19(25)24-12-16-10-15(14-4-2-1-3-5-14)6-8-21(16,13-24)20(26)27/h1-5,7,9,11,15-16H,6,8,10,12-13H2,(H,26,27)/t15-,16-,21-/m0/s1 |
| InChIKey | CJYKPMYVZIVCRY-QYWGDWMGSA-N |
| XLogP | 3.85 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |