C20H25N3O2 — CID 118777298
(3aR,6S,7aR)-2-[(5-methyl-1H-imidazol-2-yl)methyl]-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 118777298) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3aR,6S,7aR)-2-[(5-methyl-1H-imidazol-2-yl)methyl]-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-2-[(5-methyl-1H-imidazol-2-yl)methyl]-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 118777298 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3aR,6S,7aR)-2-[(5-methyl-1H-imidazol-2-yl)methyl]-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | Cc1cnc(CN2C[C@@H]3C[C@@H](c4ccccc4)CC[C@]3(C(=O)O)C2)[nH]1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-10-21-18(22-14)12-23-11-17-9-16(15-5-3-2-4-6-15)7-8-20(17,13-23)19(24)25/h2-6,10,16-17H,7-9,11-13H2,1H3,(H,21,22)(H,24,25)/t16-,17-,20-/m0/s1 |
| InChIKey | KNDPNNKGVIVWFA-ZWOKBUDYSA-N |
| XLogP | 3.19 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |