C18H24N2O3 — CID 118765698
(3aR,6S,7aR)-2-(3-aminopropanoyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 118765698) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3aR,6S,7aR)-2-(3-aminopropanoyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-2-(3-aminopropanoyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 118765698 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3aR,6S,7aR)-2-(3-aminopropanoyl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | NCCC(=O)N1C[C@@H]2C[C@@H](c3ccccc3)CC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H24N2O3/c19-9-7-16(21)20-11-15-10-14(13-4-2-1-3-5-13)6-8-18(15,12-20)17(22)23/h1-5,14-15H,6-12,19H2,(H,22,23)/t14-,15-,18-/m0/s1 |
| InChIKey | DHFPCDVCNDEJAD-MPGHIAIKSA-N |
| XLogP | 1.83 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |