C18H25NO4 — CID 118793786
(3aR,6S,7aR)-2-(1,3-dihydroxypropan-2-yl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 118793786) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (3aR,6S,7aR)-2-(1,3-dihydroxypropan-2-yl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aR,6S,7aR)-2-(1,3-dihydroxypropan-2-yl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 118793786 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (3aR,6S,7aR)-2-(1,3-dihydroxypropan-2-yl)-6-phenyl-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12CC[C@H](c3ccccc3)C[C@H]1CN(C(CO)CO)C2 |
| InChI | InChI=1S/C18H25NO4/c20-10-16(11-21)19-9-15-8-14(13-4-2-1-3-5-13)6-7-18(15,12-19)17(22)23/h1-5,14-16,20-21H,6-12H2,(H,22,23)/t14-,15-,18-/m0/s1 |
| InChIKey | YKHSKJYINSLOEJ-MPGHIAIKSA-N |
| XLogP | 1.31 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |