C14H20N2O3S — CID 118780482
N-(1,1-dioxothian-4-yl)-N-methyl-3-pyridin-4-ylpropanamide (PubChem CID 118780482) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-N-methyl-3-pyridin-4-ylpropanamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-N-methyl-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 118780482 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-N-methyl-3-pyridin-4-ylpropanamide |
| SMILES | CN(C(=O)CCc1ccncc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H20N2O3S/c1-16(13-6-10-20(18,19)11-7-13)14(17)3-2-12-4-8-15-9-5-12/h4-5,8-9,13H,2-3,6-7,10-11H2,1H3 |
| InChIKey | MNISXXZXKYLPEI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |