C17H21Br2NO4S — CID 157204339
5-(2,4-dibromophenyl)-N-(1,1-dioxothian-4-yl)-N-methyl-4-oxopentanamide (PubChem CID 157204339) has the molecular formula C17H21Br2NO4S and a molecular weight of 495.23 g/mol. Its IUPAC name is 5-(2,4-dibromophenyl)-N-(1,1-dioxothian-4-yl)-N-methyl-4-oxopentanamide.
| Compound Name | 5-(2,4-dibromophenyl)-N-(1,1-dioxothian-4-yl)-N-methyl-4-oxopentanamide |
|---|---|
| PubChem CID | 157204339 |
| Molecular Formula | C17H21Br2NO4S |
| Molecular Weight | 495.23 g/mol |
| Exact Mass | 492.96 |
| IUPAC Name | 5-(2,4-dibromophenyl)-N-(1,1-dioxothian-4-yl)-N-methyl-4-oxopentanamide |
| SMILES | CN(C(=O)CCC(=O)Cc1ccc(Br)cc1Br)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H21Br2NO4S/c1-20(14-6-8-25(23,24)9-7-14)17(22)5-4-15(21)10-12-2-3-13(18)11-16(12)19/h2-3,11,14H,4-10H2,1H3 |
| InChIKey | ARECOPLDOKSGME-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |