C12H15N9OS — CID 118783022
1-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 118783022) has the molecular formula C12H15N9OS and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 118783022 |
| Molecular Formula | C12H15N9OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | Cc1nc2c(NC(=O)NCCSc3nnnn3C)cccn2n1 |
| InChI | InChI=1S/C12H15N9OS/c1-8-14-10-9(4-3-6-21(10)17-8)15-11(22)13-5-7-23-12-16-18-19-20(12)2/h3-4,6H,5,7H2,1-2H3,(H2,13,15,22) |
| InChIKey | JMESZURKDSMUIR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|