C19H24N4O3 — CID 118785651
2-methyl-2-(3-methylphenoxy)-1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propan-1-one (PubChem CID 118785651) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-methyl-2-(3-methylphenoxy)-1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propan-1-one.
| Compound Name | 2-methyl-2-(3-methylphenoxy)-1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propan-1-one |
|---|---|
| PubChem CID | 118785651 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-methyl-2-(3-methylphenoxy)-1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]propan-1-one |
| SMILES | Cc1cccc(OC(C)(C)C(=O)N2CC[C@@H]3OCc4cnnn4[C@H]3C2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-13-5-4-6-15(9-13)26-19(2,3)18(24)22-8-7-17-16(11-22)23-14(12-25-17)10-20-21-23/h4-6,9-10,16-17H,7-8,11-12H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | YFRFPFNYLGJROU-IRXDYDNUSA-N |
| XLogP | 2.12 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |