C22H24N2 — CID 11878740
(1S,2R,6R,7S)-10,10-dimethyl-3,5-diphenyl-3,4-diazatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 11878740) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (1S,2R,6R,7S)-10,10-dimethyl-3,5-diphenyl-3,4-diazatricyclo[5.2.1.02,6]dec-4-ene.
| Compound Name | (1S,2R,6R,7S)-10,10-dimethyl-3,5-diphenyl-3,4-diazatricyclo[5.2.1.02,6]dec-4-ene |
|---|---|
| PubChem CID | 11878740 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1S,2R,6R,7S)-10,10-dimethyl-3,5-diphenyl-3,4-diazatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | CC1(C)[C@@H]2CC[C@H]1[C@H]1C(c3ccccc3)=NN(c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C22H24N2/c1-22(2)17-13-14-18(22)21-19(17)20(15-9-5-3-6-10-15)23-24(21)16-11-7-4-8-12-16/h3-12,17-19,21H,13-14H2,1-2H3/t17-,18+,19-,21+/m0/s1 |
| InChIKey | ZDLCCSXUCSBHBK-YOUFYPILSA-N |
| XLogP | 4.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |