C12H18N4 — CID 11880718
(Z)-N-(1,2,4-triazol-4-yl)-1-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methanimine (PubChem CID 11880718) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is (Z)-N-(1,2,4-triazol-4-yl)-1-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methanimine.
| Compound Name | (Z)-N-(1,2,4-triazol-4-yl)-1-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methanimine |
|---|---|
| PubChem CID | 11880718 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (Z)-N-(1,2,4-triazol-4-yl)-1-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methanimine |
| SMILES | CC1=C[C@H](C)[C@H](C=Nn2cnnc2)[C@H](C)C1 |
| InChI | InChI=1S/C12H18N4/c1-9-4-10(2)12(11(3)5-9)6-15-16-7-13-14-8-16/h4,6-8,10-12H,5H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | UAUNHPQNZAJKTA-TUAOUCFPSA-N |
| XLogP | 2.35 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|