C8H4F3NO2 — CID 118823794
4-(difluoromethoxy)-2-fluoro-1,3-benzoxazole (PubChem CID 118823794) has the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-fluoro-1,3-benzoxazole.
| Compound Name | 4-(difluoromethoxy)-2-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 118823794 |
| Molecular Formula | C8H4F3NO2 |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 4-(difluoromethoxy)-2-fluoro-1,3-benzoxazole |
| SMILES | Fc1nc2c(OC(F)F)cccc2o1 |
| InChI | InChI=1S/C8H4F3NO2/c9-7(10)13-4-2-1-3-5-6(4)12-8(11)14-5/h1-3,7H |
| InChIKey | KKEBUULIKIBPNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |