About 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid
2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid (PubChem CID 118830529) has the molecular formula C9H5F6NO3
and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid.
Analyze 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid (CID 118830529) is 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid is O=C(O)C(O)c1ccc(C(F)(F)F)c(C(F)(F)F)n1.
What is the InChIKey of 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid?
The InChIKey is RXIXEVOKEZFING-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F6NO3/c10-8(11,12)3-1-2-4(5(17)7(18)19)16-6(3)9(13,14)15/h1-2,5,17H,(H,18,19).
What are the key properties of 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid?
2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid has a molecular weight of 289.13 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,6-bis(trifluoromethyl)-2-pyridinyl]-2-hydroxyacetic acid is sourced from PubChem (CID 118830529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).