C24H25N3O8 — CID 11884492
(2S,3R)-3-[(4-acetylphenyl)carbamoyl-[(4-methoxyphenyl)methyl]amino]-1-oxalopyrrolidine-2-carboxylic acid (PubChem CID 11884492) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is (2S,3R)-3-[(4-acetylphenyl)carbamoyl-[(4-methoxyphenyl)methyl]amino]-1-oxalopyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[(4-acetylphenyl)carbamoyl-[(4-methoxyphenyl)methyl]amino]-1-oxalopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11884492 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (2S,3R)-3-[(4-acetylphenyl)carbamoyl-[(4-methoxyphenyl)methyl]amino]-1-oxalopyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(CN(C(=O)Nc2ccc(C(C)=O)cc2)[C@@H]2CCN(C(=O)C(=O)O)[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C24H25N3O8/c1-14(28)16-5-7-17(8-6-16)25-24(34)27(13-15-3-9-18(35-2)10-4-15)19-11-12-26(20(19)22(30)31)21(29)23(32)33/h3-10,19-20H,11-13H2,1-2H3,(H,25,34)(H,30,31)(H,32,33)/t19-,20+/m1/s1 |
| InChIKey | XFEGFJIXYQTMHQ-UXHICEINSA-N |
| XLogP | 2.07 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|