C8H8N2O4S — CID 118848958
2-(hydroxymethyl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 118848958) has the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 2-(hydroxymethyl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 118848958 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(hydroxymethyl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2nc(CO)oc2c1 |
| InChI | InChI=1S/C8H8N2O4S/c9-15(12,13)5-1-2-6-7(3-5)14-8(4-11)10-6/h1-3,11H,4H2,(H2,9,12,13) |
| InChIKey | GCEFHGFVSGOLSJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |