C43H42N2 — CID 118860987
3-methyl-4-[2-methyl-4-(3-methyl-N-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]anilino)phenyl]-N,N-bis(3-methylphenyl)aniline (PubChem CID 118860987) has the molecular formula C43H42N2 and a molecular weight of 586.82 g/mol. Its IUPAC name is 3-methyl-4-[2-methyl-4-(3-methyl-N-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]anilino)phenyl]-N,N-bis(3-methylphenyl)aniline.
| Compound Name | 3-methyl-4-[2-methyl-4-(3-methyl-N-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]anilino)phenyl]-N,N-bis(3-methylphenyl)aniline |
|---|---|
| PubChem CID | 118860987 |
| Molecular Formula | C43H42N2 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 3-methyl-4-[2-methyl-4-(3-methyl-N-[(3E,5Z)-octa-3,5-dien-7-yn-4-yl]anilino)phenyl]-N,N-bis(3-methylphenyl)aniline |
| SMILES | C#C/C=C\C(=C/CC)N(c1cccc(C)c1)c1ccc(-c2ccc(N(c3cccc(C)c3)c3cccc(C)c3)cc2C)c(C)c1 |
| InChI | InChI=1S/C43H42N2/c1-8-10-18-36(14-9-2)44(37-19-11-15-31(3)26-37)40-22-24-42(34(6)29-40)43-25-23-41(30-35(43)7)45(38-20-12-16-32(4)27-38)39-21-13-17-33(5)28-39/h1,10-30H,9H2,2-7H3/b18-10-,36-14+ |
| InChIKey | JNYLFWGGHFHLAM-DSBBNTCRSA-N |
| XLogP | 11.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|