C22H31N3O3 — CID 118864425
tert-butyl N-[2-cyclopentyl-1-(6-ethenyl-5-methoxy-1H-benzimidazol-2-yl)ethyl]carbamate (PubChem CID 118864425) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopentyl-1-(6-ethenyl-5-methoxy-1H-benzimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopentyl-1-(6-ethenyl-5-methoxy-1H-benzimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 118864425 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[2-cyclopentyl-1-(6-ethenyl-5-methoxy-1H-benzimidazol-2-yl)ethyl]carbamate |
| SMILES | C=Cc1cc2[nH]c(C(CC3CCCC3)NC(=O)OC(C)(C)C)nc2cc1OC |
| InChI | InChI=1S/C22H31N3O3/c1-6-15-12-16-17(13-19(15)27-5)24-20(23-16)18(11-14-9-7-8-10-14)25-21(26)28-22(2,3)4/h6,12-14,18H,1,7-11H2,2-5H3,(H,23,24)(H,25,26) |
| InChIKey | JAZNUNUUZSFMDV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |