C18H10F4N4O — CID 118871096
4-(3,4-difluorophenyl)-7-(2,6-difluoro-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine (PubChem CID 118871096) has the molecular formula C18H10F4N4O and a molecular weight of 374.30 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-7-(2,6-difluoro-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine.
| Compound Name | 4-(3,4-difluorophenyl)-7-(2,6-difluoro-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 118871096 |
| Molecular Formula | C18H10F4N4O |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)-7-(2,6-difluoro-4-pyridinyl)furo[2,3-c]pyridine-2,3-diamine |
| SMILES | Nc1oc2c(-c3cc(F)nc(F)c3)ncc(-c3ccc(F)c(F)c3)c2c1N |
| InChI | InChI=1S/C18H10F4N4O/c19-10-2-1-7(3-11(10)20)9-6-25-16(8-4-12(21)26-13(22)5-8)17-14(9)15(23)18(24)27-17/h1-6H,23-24H2 |
| InChIKey | XYATWGKGDKBWAJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|