C22H24O2 — CID 11887854
4-[(1S,2R,6S,7S)-8-(4-hydroxyphenyl)-8-tricyclo[5.2.1.02,6]decanyl]phenol (PubChem CID 11887854) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-[(1S,2R,6S,7S)-8-(4-hydroxyphenyl)-8-tricyclo[5.2.1.02,6]decanyl]phenol.
| Compound Name | 4-[(1S,2R,6S,7S)-8-(4-hydroxyphenyl)-8-tricyclo[5.2.1.02,6]decanyl]phenol |
|---|---|
| PubChem CID | 11887854 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4-[(1S,2R,6S,7S)-8-(4-hydroxyphenyl)-8-tricyclo[5.2.1.02,6]decanyl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)C[C@@H]3C[C@H]2[C@H]2CCC[C@H]32)cc1 |
| InChI | InChI=1S/C22H24O2/c23-17-8-4-15(5-9-17)22(16-6-10-18(24)11-7-16)13-14-12-21(22)20-3-1-2-19(14)20/h4-11,14,19-21,23-24H,1-3,12-13H2/t14-,19+,20-,21-/m0/s1 |
| InChIKey | WWCSTJWKTAXUGJ-MGNXDGSBSA-N |
| XLogP | 4.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |