C29H25Cl2NO3 — CID 118878739
3-(2,4-dichlorophenoxy)-2-(tritylamino)butanoic acid (PubChem CID 118878739) has the molecular formula C29H25Cl2NO3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-2-(tritylamino)butanoic acid.
| Compound Name | 3-(2,4-dichlorophenoxy)-2-(tritylamino)butanoic acid |
|---|---|
| PubChem CID | 118878739 |
| Molecular Formula | C29H25Cl2NO3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-2-(tritylamino)butanoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H25Cl2NO3/c1-20(35-26-18-17-24(30)19-25(26)31)27(28(33)34)32-29(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-20,27,32H,1H3,(H,33,34) |
| InChIKey | AXGFHBRLSNBXGC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|