C17H28O — CID 118887194
1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropoxy)benzene (PubChem CID 118887194) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropoxy)benzene.
| Compound Name | 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropoxy)benzene |
|---|---|
| PubChem CID | 118887194 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-(2,2-dimethylpropoxy)benzene |
| SMILES | CC(C)(C)CCc1cccc(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C17H28O/c1-16(2,3)11-10-14-8-7-9-15(12-14)18-13-17(4,5)6/h7-9,12H,10-11,13H2,1-6H3 |
| InChIKey | DCCORFCDSQPLMY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |