C22H33NO — CID 139767443
(E)-N-[2-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine (PubChem CID 139767443) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (E)-N-[2-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[2-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 139767443 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (E)-N-[2-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
| SMILES | CC(C)(C)C#C/C=C/CNCCc1cccc(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C22H33NO/c1-21(2,3)14-8-7-9-15-23-16-13-19-11-10-12-20(17-19)24-18-22(4,5)6/h7,9-12,17,23H,13,15-16,18H2,1-6H3/b9-7+ |
| InChIKey | JSIYCFRRALXMNL-VQHVLOKHSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|