6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid

C14H12N2O2 — CID 118891741

IUPAC6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid
SMILESO=C(O)C1Nc2ncccc2Cc2ccccc21
InChIInChI=1S/C14H12N2O2/c17-14(18)12-11-6-2-1-4-9(11)8-10-5-3-7-15-13(10)16-12/h1-7,12H,8H2,(H,15,16)(H,17,18)
InChIKeyPIHRLCOOGDKVAC-UHFFFAOYSA-N
MW240.26 g/mol
LogP2.22
Rot. Bonds1

About 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid

6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid (PubChem CID 118891741) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid.

Molecular Properties

Compound Name6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid
PubChem CID118891741
Molecular FormulaC14H12N2O2
Molecular Weight240.26 g/mol
Exact Mass240.09
IUPAC Name6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid
SMILESO=C(O)C1Nc2ncccc2Cc2ccccc21
InChIInChI=1S/C14H12N2O2/c17-14(18)12-11-6-2-1-4-9(11)8-10-5-3-7-15-13(10)16-12/h1-7,12H,8H2,(H,15,16)(H,17,18)
InChIKeyPIHRLCOOGDKVAC-UHFFFAOYSA-N
XLogP2.22
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 52.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid?
The IUPAC name of 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid (CID 118891741) is 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid.
What is the SMILES notation for 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid?
The canonical SMILES for 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid is O=C(O)C1Nc2ncccc2Cc2ccccc21.
What is the InChIKey of 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid?
The InChIKey is PIHRLCOOGDKVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c17-14(18)12-11-6-2-1-4-9(11)8-10-5-3-7-15-13(10)16-12/h1-7,12H,8H2,(H,15,16)(H,17,18).
What are the key properties of 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid?
6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid has a molecular weight of 240.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydro-5H-pyrido[2,3-c][2]benzazepine-6-carboxylic acid is sourced from PubChem (CID 118891741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).