3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

C16H15NO2 — CID 68765207

IUPAC3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
SMILESO=C(O)C1NC(c2ccccc2)Cc2ccccc21
InChIInChI=1S/C16H15NO2/c18-16(19)15-13-9-5-4-8-12(13)10-14(17-15)11-6-2-1-3-7-11/h1-9,14-15,17H,10H2,(H,18,19)
InChIKeyOQICQWGJPRYPKY-UHFFFAOYSA-N
MW253.30 g/mol
LogP2.70
Rot. Bonds2

About 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (PubChem CID 68765207) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.

Molecular Properties

Compound Name3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
PubChem CID68765207
Molecular FormulaC16H15NO2
Molecular Weight253.30 g/mol
Exact Mass253.11
IUPAC Name3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
SMILESO=C(O)C1NC(c2ccccc2)Cc2ccccc21
InChIInChI=1S/C16H15NO2/c18-16(19)15-13-9-5-4-8-12(13)10-14(17-15)11-6-2-1-3-7-11/h1-9,14-15,17H,10H2,(H,18,19)
InChIKeyOQICQWGJPRYPKY-UHFFFAOYSA-N
XLogP2.70
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.30
LogP ≤ 52.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The IUPAC name of 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CID 68765207) is 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.
What is the SMILES notation for 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The canonical SMILES for 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid is O=C(O)C1NC(c2ccccc2)Cc2ccccc21.
What is the InChIKey of 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
The InChIKey is OQICQWGJPRYPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c18-16(19)15-13-9-5-4-8-12(13)10-14(17-15)11-6-2-1-3-7-11/h1-9,14-15,17H,10H2,(H,18,19).
What are the key properties of 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid?
3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid has a molecular weight of 253.30 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid is sourced from PubChem (CID 68765207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).