C16H15NO2 — CID 68765207
3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (PubChem CID 68765207) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid.
| Compound Name | 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 68765207 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-phenyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| SMILES | O=C(O)C1NC(c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C16H15NO2/c18-16(19)15-13-9-5-4-8-12(13)10-14(17-15)11-6-2-1-3-7-11/h1-9,14-15,17H,10H2,(H,18,19) |
| InChIKey | OQICQWGJPRYPKY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |