C28H18F8O — CID 118894652
6-[[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 118894652) has the molecular formula C28H18F8O and a molecular weight of 522.44 g/mol. Its IUPAC name is 6-[[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 118894652 |
| Molecular Formula | C28H18F8O |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 6-[[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-difluoromethoxy]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C(F)(F)Oc3cc(F)c4c(F)c(F)c(F)cc4c3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H18F8O/c1-2-3-4-5-16-8-11-20(25(32)24(16)31)15-6-9-18(10-7-15)28(35,36)37-19-12-17-13-22(30)26(33)27(34)23(17)21(29)14-19/h2-3,6-14H,4-5H2,1H3/b3-2+ |
| InChIKey | NDXPHVXGELEZPP-NSCUHMNNSA-N |
| XLogP | 8.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|