C23H11F11O — CID 135223779
1-[4-[[3,5-difluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]phenoxy]-difluoromethyl]phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 135223779) has the molecular formula C23H11F11O and a molecular weight of 512.32 g/mol. Its IUPAC name is 1-[4-[[3,5-difluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]phenoxy]-difluoromethyl]phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-[[3,5-difluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]phenoxy]-difluoromethyl]phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 135223779 |
| Molecular Formula | C23H11F11O |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 1-[4-[[3,5-difluoro-4-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]phenoxy]-difluoromethyl]phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(-c2ccc(C(F)(F)Oc3cc(F)c(/C(F)=C(\F)C(F)(F)F)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C23H11F11O/c1-10-2-7-14(19(27)18(10)26)11-3-5-12(6-4-11)23(33,34)35-13-8-15(24)17(16(25)9-13)20(28)21(29)22(30,31)32/h2-9H,1H3/b21-20+ |
| InChIKey | MASMNZKRNWTSTE-QZQOTICOSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |