C12H8N4O4 — CID 118905420
2-methyl-6-(5-nitro-1,3-benzoxazol-2-yl)pyridazin-3-one (PubChem CID 118905420) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-methyl-6-(5-nitro-1,3-benzoxazol-2-yl)pyridazin-3-one.
| Compound Name | 2-methyl-6-(5-nitro-1,3-benzoxazol-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 118905420 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-methyl-6-(5-nitro-1,3-benzoxazol-2-yl)pyridazin-3-one |
| SMILES | Cn1nc(-c2nc3cc([N+](=O)[O-])ccc3o2)ccc1=O |
| InChI | InChI=1S/C12H8N4O4/c1-15-11(17)5-3-8(14-15)12-13-9-6-7(16(18)19)2-4-10(9)20-12/h2-6H,1H3 |
| InChIKey | LNDGLBFCXNOMLC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|