C10H12FIO5 — CID 118909043
[(2R,4S)-1-acetyloxy-5-fluoro-4-iodo-3-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate (PubChem CID 118909043) has the molecular formula C10H12FIO5 and a molecular weight of 358.10 g/mol. Its IUPAC name is [(2R,4S)-1-acetyloxy-5-fluoro-4-iodo-3-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate.
| Compound Name | [(2R,4S)-1-acetyloxy-5-fluoro-4-iodo-3-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118909043 |
| Molecular Formula | C10H12FIO5 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | [(2R,4S)-1-acetyloxy-5-fluoro-4-iodo-3-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](I)C2(F)CC12OC(C)=O |
| InChI | InChI=1S/C10H12FIO5/c1-5(13)15-3-7-10(17-6(2)14)4-9(10,11)8(12)16-7/h7-8H,3-4H2,1-2H3/t7-,8-,9?,10?/m1/s1 |
| InChIKey | TYXQWHQMCSELEH-LGUIWLBCSA-N |
| XLogP | 1.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|