C26H39N7O6S — CID 118912872
(2S)-6-amino-2-[[(2R)-2-[[[[(2S)-2-aminopropanoyl]amino]-[(4-methoxyphenyl)methyl]sulfamoyl]amino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 118912872) has the molecular formula C26H39N7O6S and a molecular weight of 577.71 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2-[[[[(2S)-2-aminopropanoyl]amino]-[(4-methoxyphenyl)methyl]sulfamoyl]amino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2R)-2-[[[[(2S)-2-aminopropanoyl]amino]-[(4-methoxyphenyl)methyl]sulfamoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 118912872 |
| Molecular Formula | C26H39N7O6S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2-[[[[(2S)-2-aminopropanoyl]amino]-[(4-methoxyphenyl)methyl]sulfamoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | COc1ccc(CN(NC(=O)[C@H](C)N)S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)N[C@@H](CCCCN)C(N)=O)cc1 |
| InChI | InChI=1S/C26H39N7O6S/c1-18(28)25(35)31-33(17-20-11-13-21(39-2)14-12-20)40(37,38)32-23(16-19-8-4-3-5-9-19)26(36)30-22(24(29)34)10-6-7-15-27/h3-5,8-9,11-14,18,22-23,32H,6-7,10,15-17,27-28H2,1-2H3,(H2,29,34)(H,30,36)(H,31,35)/t18-,22-,23+/m0/s1 |
| InChIKey | RDLQOZKUYJIXEG-OFAXGOBFSA-N |
| XLogP | -0.58 |
| TPSA | 211.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|