C25H32N2O7 — CID 118913716
tert-butyl 4-[4-[[2-(methoxymethyl)-6-nitrophenyl]methoxy]phenoxy]piperidine-1-carboxylate (PubChem CID 118913716) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[[2-(methoxymethyl)-6-nitrophenyl]methoxy]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[2-(methoxymethyl)-6-nitrophenyl]methoxy]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118913716 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | tert-butyl 4-[4-[[2-(methoxymethyl)-6-nitrophenyl]methoxy]phenoxy]piperidine-1-carboxylate |
| SMILES | COCc1cccc([N+](=O)[O-])c1COc1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O7/c1-25(2,3)34-24(28)26-14-12-21(13-15-26)33-20-10-8-19(9-11-20)32-17-22-18(16-31-4)6-5-7-23(22)27(29)30/h5-11,21H,12-17H2,1-4H3 |
| InChIKey | OMOCKGQLEWNHHA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|