C27H31N3O6 — CID 139910728
tert-butyl 4-[3-[(E)-4-(3-cyanophenyl)-2-hydroxybut-3-enyl]-4-nitrophenoxy]piperidine-1-carboxylate (PubChem CID 139910728) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-4-(3-cyanophenyl)-2-hydroxybut-3-enyl]-4-nitrophenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(E)-4-(3-cyanophenyl)-2-hydroxybut-3-enyl]-4-nitrophenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139910728 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | tert-butyl 4-[3-[(E)-4-(3-cyanophenyl)-2-hydroxybut-3-enyl]-4-nitrophenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(CC(O)/C=C/c3cccc(C#N)c3)c2)CC1 |
| InChI | InChI=1S/C27H31N3O6/c1-27(2,3)36-26(32)29-13-11-23(12-14-29)35-24-9-10-25(30(33)34)21(17-24)16-22(31)8-7-19-5-4-6-20(15-19)18-28/h4-10,15,17,22-23,31H,11-14,16H2,1-3H3/b8-7+ |
| InChIKey | CBDCBXOBPDDEJW-BQYQJAHWSA-N |
| XLogP | 4.86 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|