C22H20Br2 — CID 118917639
1,2-dibromo-4,9-di(propan-2-yl)pyrene (PubChem CID 118917639) has the molecular formula C22H20Br2 and a molecular weight of 444.21 g/mol. Its IUPAC name is 1,2-dibromo-4,9-di(propan-2-yl)pyrene.
| Compound Name | 1,2-dibromo-4,9-di(propan-2-yl)pyrene |
|---|---|
| PubChem CID | 118917639 |
| Molecular Formula | C22H20Br2 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | 1,2-dibromo-4,9-di(propan-2-yl)pyrene |
| SMILES | CC(C)c1cc2c(Br)c(Br)cc3c(C(C)C)cc4cccc1c4c32 |
| InChI | InChI=1S/C22H20Br2/c1-11(2)15-8-13-6-5-7-14-16(12(3)4)9-18-21(20(13)14)17(15)10-19(23)22(18)24/h5-12H,1-4H3 |
| InChIKey | OAEQQTYMBDVXMG-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|