C23H24ClN5O4 — CID 118918790
4-[4-[[[(E)-N'-[[4-(3-carboxyprop-1-enyl)phenyl]methylideneamino]carbamimidoyl]hydrazinylidene]methyl]phenyl]but-3-enoic acid;hydrochloride (PubChem CID 118918790) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is 4-[4-[[[(E)-N'-[[4-(3-carboxyprop-1-enyl)phenyl]methylideneamino]carbamimidoyl]hydrazinylidene]methyl]phenyl]but-3-enoic acid;hydrochloride.
| Compound Name | 4-[4-[[[(E)-N'-[[4-(3-carboxyprop-1-enyl)phenyl]methylideneamino]carbamimidoyl]hydrazinylidene]methyl]phenyl]but-3-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 118918790 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-[4-[[[(E)-N'-[[4-(3-carboxyprop-1-enyl)phenyl]methylideneamino]carbamimidoyl]hydrazinylidene]methyl]phenyl]but-3-enoic acid;hydrochloride |
| SMILES | Cl.N/C(=N\N=Cc1ccc(C=CCC(=O)O)cc1)NN=Cc1ccc(C=CCC(=O)O)cc1 |
| InChI | InChI=1S/C23H23N5O4.ClH/c24-23(27-25-15-19-11-7-17(8-12-19)3-1-5-21(29)30)28-26-16-20-13-9-18(10-14-20)4-2-6-22(31)32;/h1-4,7-16H,5-6H2,(H,29,30)(H,31,32)(H3,24,27,28);1H |
| InChIKey | QFOTYALEZUKMJX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|