C18H17N3O — CID 118946244
5-(5-amino-2-methylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)pyridine-3-carbonitrile (PubChem CID 118946244) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-(5-amino-2-methylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)pyridine-3-carbonitrile.
| Compound Name | 5-(5-amino-2-methylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118946244 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-(5-amino-2-methylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(N)cc1-c1cnc(C2=CCOCC2)c(C#N)c1 |
| InChI | InChI=1S/C18H17N3O/c1-12-2-3-16(20)9-17(12)15-8-14(10-19)18(21-11-15)13-4-6-22-7-5-13/h2-4,8-9,11H,5-7,20H2,1H3 |
| InChIKey | OWRXUZNMMTWKQD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|