C23H21BrN2O2 — CID 118974280
1-benzyl-5-bromo-3-[(3,4-dimethoxyphenyl)methyl]indazole (PubChem CID 118974280) has the molecular formula C23H21BrN2O2 and a molecular weight of 437.34 g/mol. Its IUPAC name is 1-benzyl-5-bromo-3-[(3,4-dimethoxyphenyl)methyl]indazole.
| Compound Name | 1-benzyl-5-bromo-3-[(3,4-dimethoxyphenyl)methyl]indazole |
|---|---|
| PubChem CID | 118974280 |
| Molecular Formula | C23H21BrN2O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 1-benzyl-5-bromo-3-[(3,4-dimethoxyphenyl)methyl]indazole |
| SMILES | COc1ccc(Cc2nn(Cc3ccccc3)c3ccc(Br)cc23)cc1OC |
| InChI | InChI=1S/C23H21BrN2O2/c1-27-22-11-8-17(13-23(22)28-2)12-20-19-14-18(24)9-10-21(19)26(25-20)15-16-6-4-3-5-7-16/h3-11,13-14H,12,15H2,1-2H3 |
| InChIKey | DAMLQKZZPBHYJH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |