C11H14N2O — CID 118988981
4-ethyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 118988981) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-ethyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-ethyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 118988981 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-ethyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCC1N=C(N)OC1c1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c1-2-9-10(14-11(12)13-9)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H2,12,13) |
| InChIKey | CJPPEGNFEKMVHZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |