C7H2Br2F4 — CID 119021867
2,4-dibromo-3-(difluoromethyl)-1,5-difluorobenzene (PubChem CID 119021867) has the molecular formula C7H2Br2F4 and a molecular weight of 321.89 g/mol. Its IUPAC name is 2,4-dibromo-3-(difluoromethyl)-1,5-difluorobenzene.
| Compound Name | 2,4-dibromo-3-(difluoromethyl)-1,5-difluorobenzene |
|---|---|
| PubChem CID | 119021867 |
| Molecular Formula | C7H2Br2F4 |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 319.85 |
| IUPAC Name | 2,4-dibromo-3-(difluoromethyl)-1,5-difluorobenzene |
| SMILES | Fc1cc(F)c(Br)c(C(F)F)c1Br |
| InChI | InChI=1S/C7H2Br2F4/c8-5-2(10)1-3(11)6(9)4(5)7(12)13/h1,7H |
| InChIKey | CBBWNFGOUKDGET-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|