C17H24N4OS — CID 119064443
1-methyl-1-[3-(4-methylphenyl)sulfanylpropyl]-3-(2-pyrazol-1-ylethyl)urea (PubChem CID 119064443) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-methyl-1-[3-(4-methylphenyl)sulfanylpropyl]-3-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-methyl-1-[3-(4-methylphenyl)sulfanylpropyl]-3-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 119064443 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-methyl-1-[3-(4-methylphenyl)sulfanylpropyl]-3-(2-pyrazol-1-ylethyl)urea |
| SMILES | Cc1ccc(SCCCN(C)C(=O)NCCn2cccn2)cc1 |
| InChI | InChI=1S/C17H24N4OS/c1-15-5-7-16(8-6-15)23-14-4-11-20(2)17(22)18-10-13-21-12-3-9-19-21/h3,5-9,12H,4,10-11,13-14H2,1-2H3,(H,18,22) |
| InChIKey | LIIFPOQKAIHTGQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|