C19H23N3O2S — CID 119073958
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide (PubChem CID 119073958) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 119073958 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(4,6,7-trimethyl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1cc(C)c2c(CC(=O)NCCCc3csc(N)n3)coc2c1C |
| InChI | InChI=1S/C19H23N3O2S/c1-11-7-12(2)17-14(9-24-18(17)13(11)3)8-16(23)21-6-4-5-15-10-25-19(20)22-15/h7,9-10H,4-6,8H2,1-3H3,(H2,20,22)(H,21,23) |
| InChIKey | BWOHBMCDWVZTIU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|