C20H40N2O2+2 — CID 11907471
3-[[(1R,4R,5S)-4-ethoxycarbonyl-3-methyl-5-pentylcyclohex-2-en-1-yl]azaniumyl]propyl-dimethylazanium (PubChem CID 11907471) has the molecular formula C20H40N2O2+2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 3-[[(1R,4R,5S)-4-ethoxycarbonyl-3-methyl-5-pentylcyclohex-2-en-1-yl]azaniumyl]propyl-dimethylazanium.
| Compound Name | 3-[[(1R,4R,5S)-4-ethoxycarbonyl-3-methyl-5-pentylcyclohex-2-en-1-yl]azaniumyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 11907471 |
| Molecular Formula | C20H40N2O2+2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 3-[[(1R,4R,5S)-4-ethoxycarbonyl-3-methyl-5-pentylcyclohex-2-en-1-yl]azaniumyl]propyl-dimethylazanium |
| SMILES | CCCCC[C@H]1C[C@@H]([NH2+]CCC[NH+](C)C)C=C(C)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C20H38N2O2/c1-6-8-9-11-17-15-18(21-12-10-13-22(4)5)14-16(3)19(17)20(23)24-7-2/h14,17-19,21H,6-13,15H2,1-5H3/p+2/t17-,18-,19-/m0/s1 |
| InChIKey | JRFXBJKUUCWENF-FHWLQOOXSA-P |
| XLogP | 1.18 |
| TPSA | 47.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|