C12H15NO2 — CID 119085152
1-hydroxy-3-propyl-3,4-dihydroquinolin-2-one (PubChem CID 119085152) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-hydroxy-3-propyl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-hydroxy-3-propyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 119085152 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-hydroxy-3-propyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCC1Cc2ccccc2N(O)C1=O |
| InChI | InChI=1S/C12H15NO2/c1-2-5-10-8-9-6-3-4-7-11(9)13(15)12(10)14/h3-4,6-7,10,15H,2,5,8H2,1H3 |
| InChIKey | GRYYEOOEVXBIIT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|