C10H9N3 — CID 119091299
2,3-dihydroindol-1-ylmethylidenecyanamide (PubChem CID 119091299) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2,3-dihydroindol-1-ylmethylidenecyanamide.
| Compound Name | 2,3-dihydroindol-1-ylmethylidenecyanamide |
|---|---|
| PubChem CID | 119091299 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2,3-dihydroindol-1-ylmethylidenecyanamide |
| SMILES | N#C/N=C/N1CCc2ccccc21 |
| InChI | InChI=1S/C10H9N3/c11-7-12-8-13-6-5-9-3-1-2-4-10(9)13/h1-4,8H,5-6H2/b12-8+ |
| InChIKey | PLEOECMSMYXXHN-XYOKQWHBSA-N |
| XLogP | 1.56 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|