C6H2Br2N2S — CID 119091432
3,5-dibromo-2-isothiocyanatopyridine (PubChem CID 119091432) has the molecular formula C6H2Br2N2S and a molecular weight of 293.97 g/mol. Its IUPAC name is 3,5-dibromo-2-isothiocyanatopyridine.
| Compound Name | 3,5-dibromo-2-isothiocyanatopyridine |
|---|---|
| PubChem CID | 119091432 |
| Molecular Formula | C6H2Br2N2S |
| Molecular Weight | 293.97 g/mol |
| Exact Mass | 291.83 |
| IUPAC Name | 3,5-dibromo-2-isothiocyanatopyridine |
| SMILES | S=C=Nc1ncc(Br)cc1Br |
| InChI | InChI=1S/C6H2Br2N2S/c7-4-1-5(8)6(9-2-4)10-3-11/h1-2H |
| InChIKey | JIJWMWNPWMQLTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|