About 2,3-dibromo-2-nitrobutane
2,3-dibromo-2-nitrobutane (PubChem CID 119095456) has the molecular formula C4H7Br2NO2
and a molecular weight of 260.91 g/mol. Its IUPAC name is 2,3-dibromo-2-nitrobutane.
Molecular Properties
| Compound Name | 2,3-dibromo-2-nitrobutane |
| PubChem CID | 119095456 |
| Molecular Formula | C4H7Br2NO2 |
| Molecular Weight | 260.91 g/mol |
| Exact Mass | 258.88 |
| IUPAC Name | 2,3-dibromo-2-nitrobutane |
| SMILES | CC(Br)C(C)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C4H7Br2NO2/c1-3(5)4(2,6)7(8)9/h3H,1-2H3 |
| InChIKey | OIRKMVDEMHAUIS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.91 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-2-nitrobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-2-nitrobutane?
The IUPAC name of 2,3-dibromo-2-nitrobutane (CID 119095456) is 2,3-dibromo-2-nitrobutane.
What is the SMILES notation for 2,3-dibromo-2-nitrobutane?
The canonical SMILES for 2,3-dibromo-2-nitrobutane is CC(Br)C(C)(Br)[N+](=O)[O-].
What is the InChIKey of 2,3-dibromo-2-nitrobutane?
The InChIKey is OIRKMVDEMHAUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Br2NO2/c1-3(5)4(2,6)7(8)9/h3H,1-2H3.
What are the key properties of 2,3-dibromo-2-nitrobutane?
2,3-dibromo-2-nitrobutane has a molecular weight of 260.91 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-2-nitrobutane is sourced from PubChem (CID 119095456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).