C8H14Br2N2O5 — CID 125484341
(2R,4R)-2,4-dibromo-2,4-dinitro-3-propan-2-yloxypentane (PubChem CID 125484341) has the molecular formula C8H14Br2N2O5 and a molecular weight of 378.02 g/mol. Its IUPAC name is (2R,4R)-2,4-dibromo-2,4-dinitro-3-propan-2-yloxypentane.
| Compound Name | (2R,4R)-2,4-dibromo-2,4-dinitro-3-propan-2-yloxypentane |
|---|---|
| PubChem CID | 125484341 |
| Molecular Formula | C8H14Br2N2O5 |
| Molecular Weight | 378.02 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | (2R,4R)-2,4-dibromo-2,4-dinitro-3-propan-2-yloxypentane |
| SMILES | CC(C)OC([C@@](C)(Br)[N+](=O)[O-])[C@@](C)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C8H14Br2N2O5/c1-5(2)17-6(7(3,9)11(13)14)8(4,10)12(15)16/h5-6H,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VWKSBTGMSVHRNH-YUMQZZPRSA-N |
| XLogP | 2.56 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.02 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|