C6H11BrO2 — CID 119097892
(E,4R)-6-bromohex-2-ene-1,4-diol (PubChem CID 119097892) has the molecular formula C6H11BrO2 and a molecular weight of 195.06 g/mol. Its IUPAC name is (E,4R)-6-bromohex-2-ene-1,4-diol.
| Compound Name | (E,4R)-6-bromohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 119097892 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (E,4R)-6-bromohex-2-ene-1,4-diol |
| SMILES | OC/C=C/[C@H](O)CCBr |
| InChI | InChI=1S/C6H11BrO2/c7-4-3-6(9)2-1-5-8/h1-2,6,8-9H,3-5H2/b2-1+/t6-/m0/s1 |
| InChIKey | QUFBRCPQOMYYSH-IPWVHJGXSA-N |
| XLogP | 0.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|