C20H25ClN3O3S+ — CID 11910291
(1S,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-5'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 11910291) has the molecular formula C20H25ClN3O3S+ and a molecular weight of 422.96 g/mol. Its IUPAC name is (1S,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-5'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-5'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 11910291 |
| Molecular Formula | C20H25ClN3O3S+ |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (1S,3S,3aR,6aS)-5-[(2R)-butan-2-yl]-5'-chloro-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC[C@@H](C)N1C(=O)[C@@H]2[C@H](CCSC)[NH2+][C@@]3(C(=O)Nc4ccc(Cl)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C20H24ClN3O3S/c1-4-10(2)24-17(25)15-14(7-8-28-3)23-20(16(15)18(24)26)12-9-11(21)5-6-13(12)22-19(20)27/h5-6,9-10,14-16,23H,4,7-8H2,1-3H3,(H,22,27)/p+1/t10-,14+,15-,16+,20-/m1/s1 |
| InChIKey | QISVXPODGKNSJE-FIBZFJQZSA-O |
| XLogP | 1.59 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|